PRODAN
Catalog No: FT-0621309
CAS No: 70504-01-7
- Chemical Name: PRODAN
- Molecular Formula: C15H17NO
- Molecular Weight: 227.3
- InChI Key: MPPQGYCZBNURDG-UHFFFAOYSA-N
- InChI: InChI=1S/C15H17NO/c1-4-15(17)13-6-5-12-10-14(16(2)3)8-7-11(12)9-13/h5-10H,4H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-propionyl-6-dimethylaminonaphthalene |
|---|---|
| Flash_Point: | 150.15ºC |
| Melting_Point: | 137ºC(lit.) |
| FW: | 227.30200 |
| Density: | 1.085g/cm3 |
| CAS: | 70504-01-7 |
| Bolling_Point: | 386.157ºC at 760 mmHg |
| MF: | C15H17NO |
| Density: | 1.085g/cm3 |
|---|---|
| LogP: | 3.49850 |
| Flash_Point: | 150.15ºC |
| Melting_Point: | 137ºC(lit.) |
| FW: | 227.30200 |
| PSA: | 20.31000 |
| Exact_Mass: | 227.13100 |
| MF: | C15H17NO |
| Bolling_Point: | 386.157ºC at 760 mmHg |
| Refractive_Index: | 1.614 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922399090 |
| Safety_Statements: | 22-24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)